2-nitrophenyl acetate


o-nitrophenyl acetate; 2-nitrophenyl acetate
Links:📖 PubMed
Formula:C8H7NO4; 181.15 g/mol
InChiKey:MRCKRGSNLOHYRA-UHFFFAOYSA-N
SMILES:CC(=O)Oc1ccccc1[N+]([O-])=O
Molecular structure of 2-nitrophenyl acetate
Melting point:41 °C
Boiling point:253 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:1.55

Isomers

5-aminobenzene-1,3-dicarboxylic acid
Molecular structure of 5-aminobenzene-1,3-dicarboxylic acid
4-aminophthalic acid
Molecular structure of 4-aminophthalic acid
2'-hydroxy-5'-nitroacetophenone
Molecular structure of 2'-hydroxy-5'-nitroacetophenone
1-(4-hydroxy-3-nitrophenyl)ethanone
Molecular structure of 1-(4-hydroxy-3-nitrophenyl)ethanone
2-methoxy-4-nitrobenzaldehyde
Molecular structure of 2-methoxy-4-nitrobenzaldehyde
2-methoxy-5-nitrobenzaldehyde
Molecular structure of 2-methoxy-5-nitrobenzaldehyde
3-methoxy-2-nitrobenzaldehyde
Molecular structure of 3-methoxy-2-nitrobenzaldehyde
4-methoxy-3-nitrobenzaldehyde
Molecular structure of 4-methoxy-3-nitrobenzaldehyde
methyl 2-nitrobenzoate
Molecular structure of methyl 2-nitrobenzoate
methyl 3-nitrobenzoate
Molecular structure of methyl 3-nitrobenzoate
methyl 4-nitrobenzoate
Molecular structure of methyl 4-nitrobenzoate
2-methyl-3-nitrobenzoic acid
Molecular structure of 2-methyl-3-nitrobenzoic acid
2-methyl-4-nitrobenzoic acid
Molecular structure of 2-methyl-4-nitrobenzoic acid
2-methyl-5-nitrobenzoic acid
Molecular structure of 2-methyl-5-nitrobenzoic acid
2-methyl-6-nitrobenzoic acid
Molecular structure of 2-methyl-6-nitrobenzoic acid
3-methyl-2-nitrobenzoic acid
Molecular structure of 3-methyl-2-nitrobenzoic acid
3-methyl-4-nitrobenzoic acid
Molecular structure of 3-methyl-4-nitrobenzoic acid
4-methyl-2-nitrobenzoic acid
Molecular structure of 4-methyl-2-nitrobenzoic acid
4-methyl-3-nitrobenzoic acid
Molecular structure of 4-methyl-3-nitrobenzoic acid
5-methyl-2-nitrobenzoic acid
Molecular structure of 5-methyl-2-nitrobenzoic acid
6-methyl-2,4-pyridinedicarboxylic acid
Molecular structure of 6-methyl-2,4-pyridinedicarboxylic acid
6-nitro-1,4-benzodioxane
Molecular structure of 6-nitro-1,4-benzodioxane
(E)-4-(5-nitrofuran-2-yl)but-3-en-2-one
Molecular structure of (E)-4-(5-nitrofuran-2-yl)but-3-en-2-one
2-nitrophenyl acetate
Molecular structure of 2-nitrophenyl acetate
3-nitrophenyl acetate
Molecular structure of 3-nitrophenyl acetate
4-nitrophenyl acetate
Molecular structure of 4-nitrophenyl acetate
2-nitrophenylacetic acid
Molecular structure of 2-nitrophenylacetic acid
3-nitrophenylacetic acid
Molecular structure of 3-nitrophenylacetic acid
4-nitrophenylacetic acid
Molecular structure of 4-nitrophenylacetic acid